C22H23LiN4O3-2 — CID 155700158
lithium;3-[2-[tert-butyl(oxomethyl)amino]-3H-pyridin-3-id-5-yl]-4-methyl-N-(1,2-oxazol-3-yl)benzamide;carbanide (PubChem CID 155700158) has the molecular formula C22H23LiN4O3-2 and a molecular weight of 398.39 g/mol. Its IUPAC name is lithium;3-[2-[tert-butyl(oxomethyl)amino]-3H-pyridin-3-id-5-yl]-4-methyl-N-(1,2-oxazol-3-yl)benzamide;carbanide.
| Compound Name | lithium;3-[2-[tert-butyl(oxomethyl)amino]-3H-pyridin-3-id-5-yl]-4-methyl-N-(1,2-oxazol-3-yl)benzamide;carbanide |
|---|---|
| PubChem CID | 155700158 |
| Molecular Formula | C22H23LiN4O3-2 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | lithium;3-[2-[tert-butyl(oxomethyl)amino]-3H-pyridin-3-id-5-yl]-4-methyl-N-(1,2-oxazol-3-yl)benzamide;carbanide |
| SMILES | Cc1ccc(C(=O)Nc2ccon2)cc1-c1c[c-]c(N([C-]=O)C(C)(C)C)nc1.[CH3-].[Li+] |
| InChI | InChI=1S/C21H20N4O3.CH3.Li/c1-14-5-6-15(20(27)23-18-9-10-28-24-18)11-17(14)16-7-8-19(22-12-16)25(13-26)21(2,3)4;;/h5-7,9-12H,1-4H3,(H,23,24,27);1H3;/q-2;-1;+1 |
| InChIKey | XWFOLQDOCURTHQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|