C14H20N4 — CID 155700475
(2E,4Z,6Z)-6-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)nona-2,4,6-trien-2-amine (PubChem CID 155700475) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is (2E,4Z,6Z)-6-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)nona-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z,6Z)-6-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)nona-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 155700475 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (2E,4Z,6Z)-6-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)nona-2,4,6-trien-2-amine |
| SMILES | CC/C=C(/C=C\C=C(/C)N)c1nnc2n1CCC2 |
| InChI | InChI=1S/C14H20N4/c1-3-6-12(8-4-7-11(2)15)14-17-16-13-9-5-10-18(13)14/h4,6-8H,3,5,9-10,15H2,1-2H3/b8-4-,11-7+,12-6- |
| InChIKey | GHGMDCCILSOABD-JBMXUKGGSA-N |
| XLogP | 2.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|