C15H22N4 — CID 155700552
(2E,4Z,6Z)-6-(5-methyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)nona-2,4,6-trien-2-amine (PubChem CID 155700552) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is (2E,4Z,6Z)-6-(5-methyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)nona-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z,6Z)-6-(5-methyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)nona-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 155700552 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (2E,4Z,6Z)-6-(5-methyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)nona-2,4,6-trien-2-amine |
| SMILES | CC/C=C(/C=C\C=C(/C)N)c1nnc2n1C(C)CC2 |
| InChI | InChI=1S/C15H22N4/c1-4-6-13(8-5-7-11(2)16)15-18-17-14-10-9-12(3)19(14)15/h5-8,12H,4,9-10,16H2,1-3H3/b8-5-,11-7+,13-6- |
| InChIKey | OLGDGOODQXNYOB-GXJUCTIVSA-N |
| XLogP | 3.00 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|