C26H25N6O2 — CID 155700921
CID 155700921 (PubChem CID 155700921) has the molecular formula C26H25N6O2 and a molecular weight of 453.53 g/mol.
| Compound Name | CID 155700921 |
|---|---|
| PubChem CID | 155700921 |
| Molecular Formula | C26H25N6O2 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | — |
| SMILES | [H]/N=C(/C#C/C(=N\[H])c1cccc(NC(=O)c2cc3c(cn2)CCN(C(=O)C2=C[CH]2)C3)n1)CCCC |
| InChI | InChI=1S/C26H25N6O2/c1-2-3-5-20(27)10-11-21(28)22-6-4-7-24(30-22)31-25(33)23-14-19-16-32(26(34)17-8-9-17)13-12-18(19)15-29-23/h4,6-9,14-15,27-28H,2-3,5,12-13,16H2,1H3,(H,30,31,33)/b27-20+,28-21+ |
| InChIKey | JXEQEXPVODZZCR-KUKFKUQFSA-N |
| XLogP | 3.34 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|