About 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten
3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten (PubChem CID 155702475) has the molecular formula C9H24N3OW-
and a molecular weight of 374.15 g/mol. Its IUPAC name is 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten.
Molecular Properties
| Compound Name | 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten |
| PubChem CID | 155702475 |
| Molecular Formula | C9H24N3OW- |
| Molecular Weight | 374.15 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten |
| SMILES | CCN.CC[N-]OCCCN(C)C.[W] |
| InChI | InChI=1S/C7H17N2O.C2H7N.W/c1-4-8-10-7-5-6-9(2)3;1-2-3;/h4-7H2,1-3H3;2-3H2,1H3;/q-1;; |
| InChIKey | LTGMIIVAGIQXDY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.15 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten?
The IUPAC name of 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten (CID 155702475) is 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten.
What is the SMILES notation for 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten?
The canonical SMILES for 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten is CCN.CC[N-]OCCCN(C)C.[W].
What is the InChIKey of 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten?
The InChIKey is LTGMIIVAGIQXDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N2O.C2H7N.W/c1-4-8-10-7-5-6-9(2)3;1-2-3;/h4-7H2,1-3H3;2-3H2,1H3;/q-1;;.
What are the key properties of 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten?
3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten has a molecular weight of 374.15 g/mol, XLogP of 1.23, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propoxy-ethylazanide;ethanamine;tungsten is sourced from PubChem (CID 155702475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).