C11H17NO — CID 155703718
6-methoxy-1,2,3,4,7,8-hexahydronaphthalen-1-amine (PubChem CID 155703718) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4,7,8-hexahydronaphthalen-1-amine.
| Compound Name | 6-methoxy-1,2,3,4,7,8-hexahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 155703718 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 6-methoxy-1,2,3,4,7,8-hexahydronaphthalen-1-amine |
| SMILES | COC1=CC2=C(CC1)C(N)CCC2 |
| InChI | InChI=1S/C11H17NO/c1-13-9-5-6-10-8(7-9)3-2-4-11(10)12/h7,11H,2-6,12H2,1H3 |
| InChIKey | DFMRZLGHCKMISN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |