C16H20ClN3O — CID 155705593
(2R)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-ethenyl-2-methylcyclopentan-1-one;ethane (PubChem CID 155705593) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is (2R)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-ethenyl-2-methylcyclopentan-1-one;ethane.
| Compound Name | (2R)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-ethenyl-2-methylcyclopentan-1-one;ethane |
|---|---|
| PubChem CID | 155705593 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (2R)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-ethenyl-2-methylcyclopentan-1-one;ethane |
| SMILES | C=C[C@@]1(C)CC(n2ccc3c(Cl)ncnc32)CC1=O.CC |
| InChI | InChI=1S/C14H14ClN3O.C2H6/c1-3-14(2)7-9(6-11(14)19)18-5-4-10-12(15)16-8-17-13(10)18;1-2/h3-5,8-9H,1,6-7H2,2H3;1-2H3/t9?,14-;/m0./s1 |
| InChIKey | KIQCZSOOAUKUCL-PUVHTRCLSA-N |
| XLogP | 4.21 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|