C8H12N2O2S — CID 155706553
(E)-3-[[amino(methylsulfanyl)methylidene]amino]-2-methylidenepent-3-enoic acid (PubChem CID 155706553) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is (E)-3-[[amino(methylsulfanyl)methylidene]amino]-2-methylidenepent-3-enoic acid.
| Compound Name | (E)-3-[[amino(methylsulfanyl)methylidene]amino]-2-methylidenepent-3-enoic acid |
|---|---|
| PubChem CID | 155706553 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (E)-3-[[amino(methylsulfanyl)methylidene]amino]-2-methylidenepent-3-enoic acid |
| SMILES | C=C(C(=O)O)C(=C\C)/N=C(/N)SC |
| InChI | InChI=1S/C8H12N2O2S/c1-4-6(5(2)7(11)12)10-8(9)13-3/h4H,2H2,1,3H3,(H2,9,10)(H,11,12)/b6-4+ |
| InChIKey | PYWDTVIQJRPFCP-GQCTYLIASA-N |
| XLogP | 1.21 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|