C17H26ClN3O3 — CID 155706657
4-amino-5-[2-chloro-3-[5-(methylamino)-5-oxopentyl]phenoxy]pentanamide (PubChem CID 155706657) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is 4-amino-5-[2-chloro-3-[5-(methylamino)-5-oxopentyl]phenoxy]pentanamide.
| Compound Name | 4-amino-5-[2-chloro-3-[5-(methylamino)-5-oxopentyl]phenoxy]pentanamide |
|---|---|
| PubChem CID | 155706657 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 4-amino-5-[2-chloro-3-[5-(methylamino)-5-oxopentyl]phenoxy]pentanamide |
| SMILES | CNC(=O)CCCCc1cccc(OCC(N)CCC(N)=O)c1Cl |
| InChI | InChI=1S/C17H26ClN3O3/c1-21-16(23)8-3-2-5-12-6-4-7-14(17(12)18)24-11-13(19)9-10-15(20)22/h4,6-7,13H,2-3,5,8-11,19H2,1H3,(H2,20,22)(H,21,23) |
| InChIKey | BKDCTWQBCUQDGS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|