C17H24ClNO4 — CID 167550365
methyl 4-[3-[(2S)-5-amino-2-methyl-5-oxopentoxy]-2-chlorophenyl]butanoate (PubChem CID 167550365) has the molecular formula C17H24ClNO4 and a molecular weight of 341.84 g/mol. Its IUPAC name is methyl 4-[3-[(2S)-5-amino-2-methyl-5-oxopentoxy]-2-chlorophenyl]butanoate.
| Compound Name | methyl 4-[3-[(2S)-5-amino-2-methyl-5-oxopentoxy]-2-chlorophenyl]butanoate |
|---|---|
| PubChem CID | 167550365 |
| Molecular Formula | C17H24ClNO4 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | methyl 4-[3-[(2S)-5-amino-2-methyl-5-oxopentoxy]-2-chlorophenyl]butanoate |
| SMILES | COC(=O)CCCc1cccc(OC[C@@H](C)CCC(N)=O)c1Cl |
| InChI | InChI=1S/C17H24ClNO4/c1-12(9-10-15(19)20)11-23-14-7-3-5-13(17(14)18)6-4-8-16(21)22-2/h3,5,7,12H,4,6,8-11H2,1-2H3,(H2,19,20)/t12-/m0/s1 |
| InChIKey | CIAKSDZEBWKBGB-LBPRGKRZSA-N |
| XLogP | 3.12 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |