C19H24ClNO4 — CID 167657484
methyl 6-[3-[(2S)-5-amino-2-methyl-5-oxopentoxy]-5-chlorophenyl]hex-5-ynoate (PubChem CID 167657484) has the molecular formula C19H24ClNO4 and a molecular weight of 365.86 g/mol. Its IUPAC name is methyl 6-[3-[(2S)-5-amino-2-methyl-5-oxopentoxy]-5-chlorophenyl]hex-5-ynoate.
| Compound Name | methyl 6-[3-[(2S)-5-amino-2-methyl-5-oxopentoxy]-5-chlorophenyl]hex-5-ynoate |
|---|---|
| PubChem CID | 167657484 |
| Molecular Formula | C19H24ClNO4 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | methyl 6-[3-[(2S)-5-amino-2-methyl-5-oxopentoxy]-5-chlorophenyl]hex-5-ynoate |
| SMILES | COC(=O)CCCC#Cc1cc(Cl)cc(OC[C@@H](C)CCC(N)=O)c1 |
| InChI | InChI=1S/C19H24ClNO4/c1-14(8-9-18(21)22)13-25-17-11-15(10-16(20)12-17)6-4-3-5-7-19(23)24-2/h10-12,14H,3,5,7-9,13H2,1-2H3,(H2,21,22)/t14-/m0/s1 |
| InChIKey | RLXQMKHXYIQRDV-AWEZNQCLSA-N |
| XLogP | 3.32 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|