C23H30F2N2O6 — CID 155189721
methyl 6-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]-2,6-difluorophenyl]hex-5-ynoate (PubChem CID 155189721) has the molecular formula C23H30F2N2O6 and a molecular weight of 468.50 g/mol. Its IUPAC name is methyl 6-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]-2,6-difluorophenyl]hex-5-ynoate.
| Compound Name | methyl 6-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]-2,6-difluorophenyl]hex-5-ynoate |
|---|---|
| PubChem CID | 155189721 |
| Molecular Formula | C23H30F2N2O6 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | methyl 6-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]-2,6-difluorophenyl]hex-5-ynoate |
| SMILES | COC(=O)CCCC#Cc1c(F)ccc(OC[C@H](CCC(N)=O)NC(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C23H30F2N2O6/c1-23(2,3)33-22(30)27-15(10-13-19(26)28)14-32-18-12-11-17(24)16(21(18)25)8-6-5-7-9-20(29)31-4/h11-12,15H,5,7,9-10,13-14H2,1-4H3,(H2,26,28)(H,27,30)/t15-/m0/s1 |
| InChIKey | KUHOUKYJPUCSEJ-HNNXBMFYSA-N |
| XLogP | 3.20 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|