C17H26N2O4S — CID 156858830
tert-butyl N-[5-amino-1-(3-methylsulfanylphenoxy)-5-oxopentan-2-yl]carbamate (PubChem CID 156858830) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-(3-methylsulfanylphenoxy)-5-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-(3-methylsulfanylphenoxy)-5-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 156858830 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | tert-butyl N-[5-amino-1-(3-methylsulfanylphenoxy)-5-oxopentan-2-yl]carbamate |
| SMILES | CSc1cccc(OCC(CCC(N)=O)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H26N2O4S/c1-17(2,3)23-16(21)19-12(8-9-15(18)20)11-22-13-6-5-7-14(10-13)24-4/h5-7,10,12H,8-9,11H2,1-4H3,(H2,18,20)(H,19,21) |
| InChIKey | KLWPXAVQYXIRQW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |