C22H34N2O6 — CID 166012938
methyl 5-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]phenyl]pentanoate (PubChem CID 166012938) has the molecular formula C22H34N2O6 and a molecular weight of 422.52 g/mol. Its IUPAC name is methyl 5-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]phenyl]pentanoate.
| Compound Name | methyl 5-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]phenyl]pentanoate |
|---|---|
| PubChem CID | 166012938 |
| Molecular Formula | C22H34N2O6 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | methyl 5-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]phenyl]pentanoate |
| SMILES | COC(=O)CCCCc1cccc(OC[C@H](CCC(N)=O)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H34N2O6/c1-22(2,3)30-21(27)24-17(12-13-19(23)25)15-29-18-10-7-9-16(14-18)8-5-6-11-20(26)28-4/h7,9-10,14,17H,5-6,8,11-13,15H2,1-4H3,(H2,23,25)(H,24,27)/t17-/m0/s1 |
| InChIKey | NFUYULJFMNWNBQ-KRWDZBQOSA-N |
| XLogP | 3.11 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|