C16H21BrF2N2O4 — CID 166747998
tert-butyl N-[5-amino-1-(3-bromo-2,5-difluorophenoxy)-5-oxopentan-2-yl]carbamate (PubChem CID 166747998) has the molecular formula C16H21BrF2N2O4 and a molecular weight of 423.25 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-(3-bromo-2,5-difluorophenoxy)-5-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-(3-bromo-2,5-difluorophenoxy)-5-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 166747998 |
| Molecular Formula | C16H21BrF2N2O4 |
| Molecular Weight | 423.25 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | tert-butyl N-[5-amino-1-(3-bromo-2,5-difluorophenoxy)-5-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCC(N)=O)COc1cc(F)cc(Br)c1F |
| InChI | InChI=1S/C16H21BrF2N2O4/c1-16(2,3)25-15(23)21-10(4-5-13(20)22)8-24-12-7-9(18)6-11(17)14(12)19/h6-7,10H,4-5,8H2,1-3H3,(H2,20,22)(H,21,23) |
| InChIKey | ZBVCNSROBXUCET-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|