C17H25BrN2O4 — CID 155707526
tert-butyl N-[5-amino-1-[(2-bromophenyl)methoxy]-5-oxopentan-2-yl]carbamate (PubChem CID 155707526) has the molecular formula C17H25BrN2O4 and a molecular weight of 401.30 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[(2-bromophenyl)methoxy]-5-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[(2-bromophenyl)methoxy]-5-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 155707526 |
| Molecular Formula | C17H25BrN2O4 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | tert-butyl N-[5-amino-1-[(2-bromophenyl)methoxy]-5-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCC(N)=O)COCc1ccccc1Br |
| InChI | InChI=1S/C17H25BrN2O4/c1-17(2,3)24-16(22)20-13(8-9-15(19)21)11-23-10-12-6-4-5-7-14(12)18/h4-7,13H,8-11H2,1-3H3,(H2,19,21)(H,20,22) |
| InChIKey | GVKXLFLNJIZGDB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |