C20H31FN2O5 — CID 166748072
tert-butyl N-[5-amino-1-[2-fluoro-3-(4-hydroxybutyl)phenoxy]-5-oxopentan-2-yl]carbamate (PubChem CID 166748072) has the molecular formula C20H31FN2O5 and a molecular weight of 398.48 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[2-fluoro-3-(4-hydroxybutyl)phenoxy]-5-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[2-fluoro-3-(4-hydroxybutyl)phenoxy]-5-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 166748072 |
| Molecular Formula | C20H31FN2O5 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | tert-butyl N-[5-amino-1-[2-fluoro-3-(4-hydroxybutyl)phenoxy]-5-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCC(N)=O)COc1cccc(CCCCO)c1F |
| InChI | InChI=1S/C20H31FN2O5/c1-20(2,3)28-19(26)23-15(10-11-17(22)25)13-27-16-9-6-8-14(18(16)21)7-4-5-12-24/h6,8-9,15,24H,4-5,7,10-13H2,1-3H3,(H2,22,25)(H,23,26) |
| InChIKey | DKVXZFPNNUEPMU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|