C24H37FN2O6 — CID 155189175
methyl 6-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]-2-fluoro-6-methylphenyl]hexanoate (PubChem CID 155189175) has the molecular formula C24H37FN2O6 and a molecular weight of 468.57 g/mol. Its IUPAC name is methyl 6-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]-2-fluoro-6-methylphenyl]hexanoate.
| Compound Name | methyl 6-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]-2-fluoro-6-methylphenyl]hexanoate |
|---|---|
| PubChem CID | 155189175 |
| Molecular Formula | C24H37FN2O6 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | methyl 6-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]-2-fluoro-6-methylphenyl]hexanoate |
| SMILES | COC(=O)CCCCCc1c(C)ccc(OC[C@H](CCC(N)=O)NC(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C24H37FN2O6/c1-16-11-13-19(22(25)18(16)9-7-6-8-10-21(29)31-5)32-15-17(12-14-20(26)28)27-23(30)33-24(2,3)4/h11,13,17H,6-10,12,14-15H2,1-5H3,(H2,26,28)(H,27,30)/t17-/m0/s1 |
| InChIKey | VHABSXZDXHBZNF-KRWDZBQOSA-N |
| XLogP | 3.95 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|