C23H35ClN2O6 — CID 155189749
methyl 6-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]-5-chlorophenyl]hexanoate (PubChem CID 155189749) has the molecular formula C23H35ClN2O6 and a molecular weight of 470.99 g/mol. Its IUPAC name is methyl 6-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]-5-chlorophenyl]hexanoate.
| Compound Name | methyl 6-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]-5-chlorophenyl]hexanoate |
|---|---|
| PubChem CID | 155189749 |
| Molecular Formula | C23H35ClN2O6 |
| Molecular Weight | 470.99 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | methyl 6-[3-[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentoxy]-5-chlorophenyl]hexanoate |
| SMILES | COC(=O)CCCCCc1cc(Cl)cc(OC[C@H](CCC(N)=O)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H35ClN2O6/c1-23(2,3)32-22(29)26-18(10-11-20(25)27)15-31-19-13-16(12-17(24)14-19)8-6-5-7-9-21(28)30-4/h12-14,18H,5-11,15H2,1-4H3,(H2,25,27)(H,26,29)/t18-/m0/s1 |
| InChIKey | QHBLYMBLHRGWDK-SFHVURJKSA-N |
| XLogP | 4.15 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.99 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|