C18H26ClN3O4 — CID 170208907
6-[3-[(2S)-5-amino-2-formamido-5-oxopentoxy]-5-chlorophenyl]hexanamide (PubChem CID 170208907) has the molecular formula C18H26ClN3O4 and a molecular weight of 383.88 g/mol. Its IUPAC name is 6-[3-[(2S)-5-amino-2-formamido-5-oxopentoxy]-5-chlorophenyl]hexanamide.
| Compound Name | 6-[3-[(2S)-5-amino-2-formamido-5-oxopentoxy]-5-chlorophenyl]hexanamide |
|---|---|
| PubChem CID | 170208907 |
| Molecular Formula | C18H26ClN3O4 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 6-[3-[(2S)-5-amino-2-formamido-5-oxopentoxy]-5-chlorophenyl]hexanamide |
| SMILES | NC(=O)CCCCCc1cc(Cl)cc(OC[C@H](CCC(N)=O)NC=O)c1 |
| InChI | InChI=1S/C18H26ClN3O4/c19-14-8-13(4-2-1-3-5-17(20)24)9-16(10-14)26-11-15(22-12-23)6-7-18(21)25/h8-10,12,15H,1-7,11H2,(H2,20,24)(H2,21,25)(H,22,23)/t15-/m0/s1 |
| InChIKey | GUDPXOOEJDPROX-HNNXBMFYSA-N |
| XLogP | 1.69 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|