C18H28FN3O3 — CID 155706907
6-[5-(2,5-diamino-5-oxopentoxy)-2-fluorophenyl]-N-methylhexanamide (PubChem CID 155706907) has the molecular formula C18H28FN3O3 and a molecular weight of 353.44 g/mol. Its IUPAC name is 6-[5-(2,5-diamino-5-oxopentoxy)-2-fluorophenyl]-N-methylhexanamide.
| Compound Name | 6-[5-(2,5-diamino-5-oxopentoxy)-2-fluorophenyl]-N-methylhexanamide |
|---|---|
| PubChem CID | 155706907 |
| Molecular Formula | C18H28FN3O3 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 6-[5-(2,5-diamino-5-oxopentoxy)-2-fluorophenyl]-N-methylhexanamide |
| SMILES | CNC(=O)CCCCCc1cc(OCC(N)CCC(N)=O)ccc1F |
| InChI | InChI=1S/C18H28FN3O3/c1-22-18(24)6-4-2-3-5-13-11-15(8-9-16(13)19)25-12-14(20)7-10-17(21)23/h8-9,11,14H,2-7,10,12,20H2,1H3,(H2,21,23)(H,22,24) |
| InChIKey | ZLFQGTKVJKQWKN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|