C18H25ClFNO4 — CID 167653385
6-[3-[(2S)-5-amino-2-methyl-5-oxopentoxy]-5-chloro-2-fluorophenyl]hexanoic acid (PubChem CID 167653385) has the molecular formula C18H25ClFNO4 and a molecular weight of 373.85 g/mol. Its IUPAC name is 6-[3-[(2S)-5-amino-2-methyl-5-oxopentoxy]-5-chloro-2-fluorophenyl]hexanoic acid.
| Compound Name | 6-[3-[(2S)-5-amino-2-methyl-5-oxopentoxy]-5-chloro-2-fluorophenyl]hexanoic acid |
|---|---|
| PubChem CID | 167653385 |
| Molecular Formula | C18H25ClFNO4 |
| Molecular Weight | 373.85 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 6-[3-[(2S)-5-amino-2-methyl-5-oxopentoxy]-5-chloro-2-fluorophenyl]hexanoic acid |
| SMILES | C[C@@H](CCC(N)=O)COc1cc(Cl)cc(CCCCCC(=O)O)c1F |
| InChI | InChI=1S/C18H25ClFNO4/c1-12(7-8-16(21)22)11-25-15-10-14(19)9-13(18(15)20)5-3-2-4-6-17(23)24/h9-10,12H,2-8,11H2,1H3,(H2,21,22)(H,23,24)/t12-/m0/s1 |
| InChIKey | QXDVJMKEUYWZCU-LBPRGKRZSA-N |
| XLogP | 3.95 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|