C19H28FN3O4 — CID 155707244
6-[3-(5-amino-2-formamido-5-oxopentoxy)-6-fluoro-2-methylphenyl]hexanamide (PubChem CID 155707244) has the molecular formula C19H28FN3O4 and a molecular weight of 381.45 g/mol. Its IUPAC name is 6-[3-(5-amino-2-formamido-5-oxopentoxy)-6-fluoro-2-methylphenyl]hexanamide.
| Compound Name | 6-[3-(5-amino-2-formamido-5-oxopentoxy)-6-fluoro-2-methylphenyl]hexanamide |
|---|---|
| PubChem CID | 155707244 |
| Molecular Formula | C19H28FN3O4 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 6-[3-(5-amino-2-formamido-5-oxopentoxy)-6-fluoro-2-methylphenyl]hexanamide |
| SMILES | Cc1c(OCC(CCC(N)=O)NC=O)ccc(F)c1CCCCCC(N)=O |
| InChI | InChI=1S/C19H28FN3O4/c1-13-15(5-3-2-4-6-18(21)25)16(20)8-9-17(13)27-11-14(23-12-24)7-10-19(22)26/h8-9,12,14H,2-7,10-11H2,1H3,(H2,21,25)(H2,22,26)(H,23,24) |
| InChIKey | XRWFFPLBTSGOAN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|