C18H24FN3O5 — CID 170209143
[4-(5-amino-5-oxopentyl)-2-fluorophenyl]methyl (2S)-5-amino-2-formamido-5-oxopentanoate (PubChem CID 170209143) has the molecular formula C18H24FN3O5 and a molecular weight of 381.40 g/mol. Its IUPAC name is [4-(5-amino-5-oxopentyl)-2-fluorophenyl]methyl (2S)-5-amino-2-formamido-5-oxopentanoate.
| Compound Name | [4-(5-amino-5-oxopentyl)-2-fluorophenyl]methyl (2S)-5-amino-2-formamido-5-oxopentanoate |
|---|---|
| PubChem CID | 170209143 |
| Molecular Formula | C18H24FN3O5 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [4-(5-amino-5-oxopentyl)-2-fluorophenyl]methyl (2S)-5-amino-2-formamido-5-oxopentanoate |
| SMILES | NC(=O)CCCCc1ccc(COC(=O)[C@H](CCC(N)=O)NC=O)c(F)c1 |
| InChI | InChI=1S/C18H24FN3O5/c19-14-9-12(3-1-2-4-16(20)24)5-6-13(14)10-27-18(26)15(22-11-23)7-8-17(21)25/h5-6,9,11,15H,1-4,7-8,10H2,(H2,20,24)(H2,21,25)(H,22,23)/t15-/m0/s1 |
| InChIKey | QQZKUNRYXITYQN-HNNXBMFYSA-N |
| XLogP | 0.45 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|