C16H21FN2O4 — CID 170916547
(2S)-5-amino-2-[[2-(3-fluoro-4-propan-2-ylphenyl)acetyl]amino]-5-oxopentanoic acid (PubChem CID 170916547) has the molecular formula C16H21FN2O4 and a molecular weight of 324.35 g/mol. Its IUPAC name is (2S)-5-amino-2-[[2-(3-fluoro-4-propan-2-ylphenyl)acetyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[2-(3-fluoro-4-propan-2-ylphenyl)acetyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 170916547 |
| Molecular Formula | C16H21FN2O4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2S)-5-amino-2-[[2-(3-fluoro-4-propan-2-ylphenyl)acetyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)c1ccc(CC(=O)N[C@@H](CCC(N)=O)C(=O)O)cc1F |
| InChI | InChI=1S/C16H21FN2O4/c1-9(2)11-4-3-10(7-12(11)17)8-15(21)19-13(16(22)23)5-6-14(18)20/h3-4,7,9,13H,5-6,8H2,1-2H3,(H2,18,20)(H,19,21)(H,22,23)/t13-/m0/s1 |
| InChIKey | LCDOXNLAKYODNM-ZDUSSCGKSA-N |
| XLogP | 1.33 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |