C15H22N2O3 — CID 170200819
(4S,5R)-4-formamido-5-[(4-methylphenyl)methoxy]hexanamide (PubChem CID 170200819) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is (4S,5R)-4-formamido-5-[(4-methylphenyl)methoxy]hexanamide.
| Compound Name | (4S,5R)-4-formamido-5-[(4-methylphenyl)methoxy]hexanamide |
|---|---|
| PubChem CID | 170200819 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (4S,5R)-4-formamido-5-[(4-methylphenyl)methoxy]hexanamide |
| SMILES | Cc1ccc(CO[C@H](C)[C@H](CCC(N)=O)NC=O)cc1 |
| InChI | InChI=1S/C15H22N2O3/c1-11-3-5-13(6-4-11)9-20-12(2)14(17-10-18)7-8-15(16)19/h3-6,10,12,14H,7-9H2,1-2H3,(H2,16,19)(H,17,18)/t12-,14+/m1/s1 |
| InChIKey | LYMYJJNWDBSMMH-OCCSQVGLSA-N |
| XLogP | 1.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|