C18H26BrNO3 — CID 77432172
tert-butyl N-[1-[[2-(bromomethyl)phenyl]methoxy]pent-4-en-2-yl]carbamate (PubChem CID 77432172) has the molecular formula C18H26BrNO3 and a molecular weight of 384.31 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(bromomethyl)phenyl]methoxy]pent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(bromomethyl)phenyl]methoxy]pent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 77432172 |
| Molecular Formula | C18H26BrNO3 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | tert-butyl N-[1-[[2-(bromomethyl)phenyl]methoxy]pent-4-en-2-yl]carbamate |
| SMILES | C=CCC(COCc1ccccc1CBr)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26BrNO3/c1-5-8-16(20-17(21)23-18(2,3)4)13-22-12-15-10-7-6-9-14(15)11-19/h5-7,9-10,16H,1,8,11-13H2,2-4H3,(H,20,21) |
| InChIKey | YCHOOOKNACVRDJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|