C29H39FN8O — CID 155708049
4-[8-[2-[4-(3-aminopyrrolidin-1-yl)phenyl]ethyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-3-fluoropyrazolo[1,5-a]pyridine-7-carbonitrile;methanol (PubChem CID 155708049) has the molecular formula C29H39FN8O and a molecular weight of 534.68 g/mol. Its IUPAC name is 4-[8-[2-[4-(3-aminopyrrolidin-1-yl)phenyl]ethyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-3-fluoropyrazolo[1,5-a]pyridine-7-carbonitrile;methanol.
| Compound Name | 4-[8-[2-[4-(3-aminopyrrolidin-1-yl)phenyl]ethyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-3-fluoropyrazolo[1,5-a]pyridine-7-carbonitrile;methanol |
|---|---|
| PubChem CID | 155708049 |
| Molecular Formula | C29H39FN8O |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | 4-[8-[2-[4-(3-aminopyrrolidin-1-yl)phenyl]ethyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-3-fluoropyrazolo[1,5-a]pyridine-7-carbonitrile;methanol |
| SMILES | CC1CN(c2ccc(C#N)n3ncc(F)c23)CC2CN(CCc3ccc(N4CCC(N)C4)cc3)CCN12.CO |
| InChI | InChI=1S/C28H35FN8.CH4O/c1-20-16-35(27-7-6-24(14-30)37-28(27)26(29)15-32-37)19-25-18-33(12-13-36(20)25)10-8-21-2-4-23(5-3-21)34-11-9-22(31)17-34;1-2/h2-7,15,20,22,25H,8-13,16-19,31H2,1H3;2H,1H3 |
| InChIKey | WQTLIXLVUCAUGI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|