C17H14N4O3 — CID 155709058
2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]-1-methylbenzimidazole-5-carbaldehyde (PubChem CID 155709058) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]-1-methylbenzimidazole-5-carbaldehyde.
| Compound Name | 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]-1-methylbenzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 155709058 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]-1-methylbenzimidazole-5-carbaldehyde |
| SMILES | COc1ccc2nc(Nc3nc4cc(C=O)ccc4n3C)oc2c1 |
| InChI | InChI=1S/C17H14N4O3/c1-21-14-6-3-10(9-22)7-13(14)18-16(21)20-17-19-12-5-4-11(23-2)8-15(12)24-17/h3-9H,1-2H3,(H,18,19,20) |
| InChIKey | XKFWRBIRGBCGLQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|