C10H8N4O3 — CID 148691871
6-methoxy-N-(1,3,4-oxadiazol-2-yl)-1,3-benzoxazol-2-amine (PubChem CID 148691871) has the molecular formula C10H8N4O3 and a molecular weight of 232.20 g/mol. Its IUPAC name is 6-methoxy-N-(1,3,4-oxadiazol-2-yl)-1,3-benzoxazol-2-amine.
| Compound Name | 6-methoxy-N-(1,3,4-oxadiazol-2-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 148691871 |
| Molecular Formula | C10H8N4O3 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 6-methoxy-N-(1,3,4-oxadiazol-2-yl)-1,3-benzoxazol-2-amine |
| SMILES | COc1ccc2nc(Nc3nnco3)oc2c1 |
| InChI | InChI=1S/C10H8N4O3/c1-15-6-2-3-7-8(4-6)17-9(12-7)13-10-14-11-5-16-10/h2-5H,1H3,(H,12,13,14) |
| InChIKey | NTQGKRLRWVEGTF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |