C28H35FN8O — CID 155709282
4-[[(1E,3Z)-6-cyano-2-fluoro-6-methyl-1-(methylideneamino)hepta-1,3-dienyl]amino]-2-[(1,1-dimethyl-3,4-dihydro-2H-isoquinolin-6-yl)amino]-N-ethylpyrimidine-5-carboxamide (PubChem CID 155709282) has the molecular formula C28H35FN8O and a molecular weight of 518.64 g/mol. Its IUPAC name is 4-[[(1E,3Z)-6-cyano-2-fluoro-6-methyl-1-(methylideneamino)hepta-1,3-dienyl]amino]-2-[(1,1-dimethyl-3,4-dihydro-2H-isoquinolin-6-yl)amino]-N-ethylpyrimidine-5-carboxamide.
| Compound Name | 4-[[(1E,3Z)-6-cyano-2-fluoro-6-methyl-1-(methylideneamino)hepta-1,3-dienyl]amino]-2-[(1,1-dimethyl-3,4-dihydro-2H-isoquinolin-6-yl)amino]-N-ethylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155709282 |
| Molecular Formula | C28H35FN8O |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 4-[[(1E,3Z)-6-cyano-2-fluoro-6-methyl-1-(methylideneamino)hepta-1,3-dienyl]amino]-2-[(1,1-dimethyl-3,4-dihydro-2H-isoquinolin-6-yl)amino]-N-ethylpyrimidine-5-carboxamide |
| SMILES | C=N/C(Nc1nc(Nc2ccc3c(c2)CCNC3(C)C)ncc1C(=O)NCC)=C(F)\C=C/CC(C)(C)C#N |
| InChI | InChI=1S/C28H35FN8O/c1-7-32-25(38)20-16-33-26(35-19-10-11-21-18(15-19)12-14-34-28(21,4)5)37-23(20)36-24(31-6)22(29)9-8-13-27(2,3)17-30/h8-11,15-16,34H,6-7,12-14H2,1-5H3,(H,32,38)(H2,33,35,36,37)/b9-8-,24-22- |
| InChIKey | GICWZMOAGIYOEQ-JFJXQQFKSA-N |
| XLogP | 5.10 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|