C15H24N3OY- — CID 155709754
1-[2-[3-(methoxymethyl)piperazin-1-yl]benzene-5-id-1-yl]-N,N-dimethylmethanamine;yttrium (PubChem CID 155709754) has the molecular formula C15H24N3OY- and a molecular weight of 351.28 g/mol. Its IUPAC name is 1-[2-[3-(methoxymethyl)piperazin-1-yl]benzene-5-id-1-yl]-N,N-dimethylmethanamine;yttrium.
| Compound Name | 1-[2-[3-(methoxymethyl)piperazin-1-yl]benzene-5-id-1-yl]-N,N-dimethylmethanamine;yttrium |
|---|---|
| PubChem CID | 155709754 |
| Molecular Formula | C15H24N3OY- |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 1-[2-[3-(methoxymethyl)piperazin-1-yl]benzene-5-id-1-yl]-N,N-dimethylmethanamine;yttrium |
| SMILES | COCC1CN(c2cc[c-]cc2CN(C)C)CCN1.[Y] |
| InChI | InChI=1S/C15H24N3O.Y/c1-17(2)10-13-6-4-5-7-15(13)18-9-8-16-14(11-18)12-19-3;/h5-7,14,16H,8-12H2,1-3H3;/q-1; |
| InChIKey | NCJRLMHCKOGXEO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|