C21H38F2N4 — CID 155709921
1-N-[4-[(5E,6Z)-5-(aminomethylidene)-3,4-dihydro-2H-azocin-8-yl]butyl]-1-N-(2,2-difluoroethyl)butane-1,3-diamine;prop-1-ene (PubChem CID 155709921) has the molecular formula C21H38F2N4 and a molecular weight of 384.56 g/mol. Its IUPAC name is 1-N-[4-[(5E,6Z)-5-(aminomethylidene)-3,4-dihydro-2H-azocin-8-yl]butyl]-1-N-(2,2-difluoroethyl)butane-1,3-diamine;prop-1-ene.
| Compound Name | 1-N-[4-[(5E,6Z)-5-(aminomethylidene)-3,4-dihydro-2H-azocin-8-yl]butyl]-1-N-(2,2-difluoroethyl)butane-1,3-diamine;prop-1-ene |
|---|---|
| PubChem CID | 155709921 |
| Molecular Formula | C21H38F2N4 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | 1-N-[4-[(5E,6Z)-5-(aminomethylidene)-3,4-dihydro-2H-azocin-8-yl]butyl]-1-N-(2,2-difluoroethyl)butane-1,3-diamine;prop-1-ene |
| SMILES | C=CC.CC(N)CCN(CCCCC1=N/CCCC(=C\N)/C=C\1)CC(F)F |
| InChI | InChI=1S/C18H32F2N4.C3H6/c1-15(22)9-12-24(14-18(19)20)11-3-2-6-17-8-7-16(13-21)5-4-10-23-17;1-3-2/h7-8,13,15,18H,2-6,9-12,14,21-22H2,1H3;3H,1H2,2H3/b8-7-,16-13+,23-17-; |
| InChIKey | IBVRCKXOQBKSPN-YQSHJELOSA-N |
| XLogP | 4.29 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|