C19H35F2N3 — CID 155709907
(1E,3Z)-N'-butyl-N'-(3,3-difluoropropyl)-2-ethyl-5-methyliminonona-1,3-diene-1,9-diamine (PubChem CID 155709907) has the molecular formula C19H35F2N3 and a molecular weight of 343.51 g/mol. Its IUPAC name is (1E,3Z)-N'-butyl-N'-(3,3-difluoropropyl)-2-ethyl-5-methyliminonona-1,3-diene-1,9-diamine.
| Compound Name | (1E,3Z)-N'-butyl-N'-(3,3-difluoropropyl)-2-ethyl-5-methyliminonona-1,3-diene-1,9-diamine |
|---|---|
| PubChem CID | 155709907 |
| Molecular Formula | C19H35F2N3 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.28 |
| IUPAC Name | (1E,3Z)-N'-butyl-N'-(3,3-difluoropropyl)-2-ethyl-5-methyliminonona-1,3-diene-1,9-diamine |
| SMILES | CCCCN(CCCCC(/C=C\C(=C\N)CC)=N\C)CCC(F)F |
| InChI | InChI=1S/C19H35F2N3/c1-4-6-13-24(15-12-19(20)21)14-8-7-9-18(23-3)11-10-17(5-2)16-22/h10-11,16,19H,4-9,12-15,22H2,1-3H3/b11-10-,17-16+,23-18+ |
| InChIKey | WXEDCOFVFLJPDW-PRPBCIMXSA-N |
| XLogP | 4.79 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|