C14H19NO3 — CID 155710089
(2E,7Z,9Z)-2,9-dimethyl-7-(methylideneamino)-6-oxoundeca-2,7,9-trienoic acid (PubChem CID 155710089) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (2E,7Z,9Z)-2,9-dimethyl-7-(methylideneamino)-6-oxoundeca-2,7,9-trienoic acid.
| Compound Name | (2E,7Z,9Z)-2,9-dimethyl-7-(methylideneamino)-6-oxoundeca-2,7,9-trienoic acid |
|---|---|
| PubChem CID | 155710089 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (2E,7Z,9Z)-2,9-dimethyl-7-(methylideneamino)-6-oxoundeca-2,7,9-trienoic acid |
| SMILES | C=N/C(=C\C(C)=C/C)C(=O)CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C14H19NO3/c1-5-10(2)9-12(15-4)13(16)8-6-7-11(3)14(17)18/h5,7,9H,4,6,8H2,1-3H3,(H,17,18)/b10-5-,11-7+,12-9- |
| InChIKey | HOUWWVRVFDAFAG-FDMNTEKSSA-N |
| XLogP | 2.92 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|