C8H10BrNO2 — CID 174256022
(2Z,4E)-5-bromo-4-methyl-2-(methylideneamino)hexa-2,4-dienoic acid (PubChem CID 174256022) has the molecular formula C8H10BrNO2 and a molecular weight of 232.08 g/mol. Its IUPAC name is (2Z,4E)-5-bromo-4-methyl-2-(methylideneamino)hexa-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-bromo-4-methyl-2-(methylideneamino)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 174256022 |
| Molecular Formula | C8H10BrNO2 |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | (2Z,4E)-5-bromo-4-methyl-2-(methylideneamino)hexa-2,4-dienoic acid |
| SMILES | C=N/C(=C\C(C)=C(/C)Br)C(=O)O |
| InChI | InChI=1S/C8H10BrNO2/c1-5(6(2)9)4-7(10-3)8(11)12/h4H,3H2,1-2H3,(H,11,12)/b6-5+,7-4- |
| InChIKey | SRWBXVKKMBCFMN-NRVNPBJCSA-N |
| XLogP | 2.34 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|