C11H14F3NO3 — CID 166951328
(2Z,4E)-2-(methylideneamino)-5-(4,4,4-trifluorobutoxy)hexa-2,4-dienoic acid (PubChem CID 166951328) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is (2Z,4E)-2-(methylideneamino)-5-(4,4,4-trifluorobutoxy)hexa-2,4-dienoic acid.
| Compound Name | (2Z,4E)-2-(methylideneamino)-5-(4,4,4-trifluorobutoxy)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 166951328 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (2Z,4E)-2-(methylideneamino)-5-(4,4,4-trifluorobutoxy)hexa-2,4-dienoic acid |
| SMILES | C=N/C(=C\C=C(/C)OCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H14F3NO3/c1-8(4-5-9(15-2)10(16)17)18-7-3-6-11(12,13)14/h4-5H,2-3,6-7H2,1H3,(H,16,17)/b8-4+,9-5- |
| InChIKey | BNEQIXIUXHTFGS-HXGSSHHBSA-N |
| XLogP | 2.92 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|