C12H19F3O2S — CID 174079736
(5Z)-2-methyl-6-sulfanyl-5-(4,4,4-trifluorobutoxy)hepta-3,5-dien-3-ol (PubChem CID 174079736) has the molecular formula C12H19F3O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is (5Z)-2-methyl-6-sulfanyl-5-(4,4,4-trifluorobutoxy)hepta-3,5-dien-3-ol.
| Compound Name | (5Z)-2-methyl-6-sulfanyl-5-(4,4,4-trifluorobutoxy)hepta-3,5-dien-3-ol |
|---|---|
| PubChem CID | 174079736 |
| Molecular Formula | C12H19F3O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (5Z)-2-methyl-6-sulfanyl-5-(4,4,4-trifluorobutoxy)hepta-3,5-dien-3-ol |
| SMILES | C/C(S)=C(\C=C(O)C(C)C)OCCCC(F)(F)F |
| InChI | InChI=1S/C12H19F3O2S/c1-8(2)10(16)7-11(9(3)18)17-6-4-5-12(13,14)15/h7-8,16,18H,4-6H2,1-3H3/b10-7?,11-9- |
| InChIKey | SXZSZCNBHBCTIF-VDMHUTFVSA-N |
| XLogP | 4.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|