C31H31BN4O5 — CID 155710258
CID 155710258 (PubChem CID 155710258) has the molecular formula C31H31BN4O5 and a molecular weight of 550.42 g/mol.
| Compound Name | CID 155710258 |
|---|---|
| PubChem CID | 155710258 |
| Molecular Formula | C31H31BN4O5 |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | — |
| SMILES | [B]C(O)(c1ccc(CN2CCC3(CCCO3)CC2)cc1)c1ncc2c3c(cccc13)C(=O)N2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C31H31BN4O5/c32-31(40,20-7-5-19(6-8-20)18-35-14-12-30(13-15-35)11-2-16-41-30)27-21-3-1-4-22-26(21)24(17-33-27)36(29(22)39)23-9-10-25(37)34-28(23)38/h1,3-8,17,23,40H,2,9-16,18H2,(H,34,37,38) |
| InChIKey | VJYWKNMPVRMRRH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|