C31H32N4O4 — CID 164836543
3-[3-oxo-9-[[4-[(7,7,9,9-tetradeuterio-1-oxa-8-azaspiro[4.5]decan-8-yl)methyl]phenyl]methyl]-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione (PubChem CID 164836543) has the molecular formula C31H32N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is 3-[3-oxo-9-[[4-[(7,7,9,9-tetradeuterio-1-oxa-8-azaspiro[4.5]decan-8-yl)methyl]phenyl]methyl]-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-9-[[4-[(7,7,9,9-tetradeuterio-1-oxa-8-azaspiro[4.5]decan-8-yl)methyl]phenyl]methyl]-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164836543 |
| Molecular Formula | C31H32N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 3-[3-oxo-9-[[4-[(7,7,9,9-tetradeuterio-1-oxa-8-azaspiro[4.5]decan-8-yl)methyl]phenyl]methyl]-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C1([2H])CC2(CCCO2)CC([2H])([2H])N1Cc1ccc(Cc2ncc3c4c(cccc24)C(=O)N3C2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C31H32N4O4/c36-27-10-9-25(29(37)33-27)35-26-18-32-24(22-3-1-4-23(28(22)26)30(35)38)17-20-5-7-21(8-6-20)19-34-14-12-31(13-15-34)11-2-16-39-31/h1,3-8,18,25H,2,9-17,19H2,(H,33,36,37)/i14D2,15D2 |
| InChIKey | MXGJVXVPGJHIOW-QZPARXMSSA-N |
| XLogP | 3.74 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|