C15H10F6N4OS — CID 155714917
3-methyl-6-(2,2,2-trifluoroethyl)-1-[3-(trifluoromethoxy)phenyl]-7H-pyrazolo[5,4-d]pyrimidine-4-thione (PubChem CID 155714917) has the molecular formula C15H10F6N4OS and a molecular weight of 408.33 g/mol. Its IUPAC name is 3-methyl-6-(2,2,2-trifluoroethyl)-1-[3-(trifluoromethoxy)phenyl]-7H-pyrazolo[5,4-d]pyrimidine-4-thione.
| Compound Name | 3-methyl-6-(2,2,2-trifluoroethyl)-1-[3-(trifluoromethoxy)phenyl]-7H-pyrazolo[5,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 155714917 |
| Molecular Formula | C15H10F6N4OS |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 3-methyl-6-(2,2,2-trifluoroethyl)-1-[3-(trifluoromethoxy)phenyl]-7H-pyrazolo[5,4-d]pyrimidine-4-thione |
| SMILES | Cc1nn(-c2cccc(OC(F)(F)F)c2)c2[nH]c(CC(F)(F)F)nc(=S)c12 |
| InChI | InChI=1S/C15H10F6N4OS/c1-7-11-12(22-10(23-13(11)27)6-14(16,17)18)25(24-7)8-3-2-4-9(5-8)26-15(19,20)21/h2-5H,6H2,1H3,(H,22,23,27) |
| InChIKey | UAGODJMCKRVXGJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|