C14H8F6N4S — CID 155714923
1-(3-fluorophenyl)-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-d]pyrimidine-4-thione (PubChem CID 155714923) has the molecular formula C14H8F6N4S and a molecular weight of 378.30 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-d]pyrimidine-4-thione.
| Compound Name | 1-(3-fluorophenyl)-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 155714923 |
| Molecular Formula | C14H8F6N4S |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 1-(3-fluorophenyl)-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-d]pyrimidine-4-thione |
| SMILES | Cc1nn(-c2cccc(F)c2)c2[nH]c(C(F)(F)C(F)(F)F)nc(=S)c12 |
| InChI | InChI=1S/C14H8F6N4S/c1-6-9-10(24(23-6)8-4-2-3-7(15)5-8)21-12(22-11(9)25)13(16,17)14(18,19)20/h2-5H,1H3,(H,21,22,25) |
| InChIKey | OMBGGTAKTUUIAR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|