C13H8ClF3N4S — CID 155714925
1-(4-chlorophenyl)-3-methyl-6-(trifluoromethyl)-7H-pyrazolo[5,4-d]pyrimidine-4-thione (PubChem CID 155714925) has the molecular formula C13H8ClF3N4S and a molecular weight of 344.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-methyl-6-(trifluoromethyl)-7H-pyrazolo[5,4-d]pyrimidine-4-thione.
| Compound Name | 1-(4-chlorophenyl)-3-methyl-6-(trifluoromethyl)-7H-pyrazolo[5,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 155714925 |
| Molecular Formula | C13H8ClF3N4S |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 1-(4-chlorophenyl)-3-methyl-6-(trifluoromethyl)-7H-pyrazolo[5,4-d]pyrimidine-4-thione |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c2[nH]c(C(F)(F)F)nc(=S)c12 |
| InChI | InChI=1S/C13H8ClF3N4S/c1-6-9-10(18-12(13(15,16)17)19-11(9)22)21(20-6)8-4-2-7(14)3-5-8/h2-5H,1H3,(H,18,19,22) |
| InChIKey | RQXWESAIEHOZHE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|