C11H12N2O — CID 155718046
2-methyl-5-(5-methyl-1,2-oxazol-4-yl)aniline (PubChem CID 155718046) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-methyl-5-(5-methyl-1,2-oxazol-4-yl)aniline.
| Compound Name | 2-methyl-5-(5-methyl-1,2-oxazol-4-yl)aniline |
|---|---|
| PubChem CID | 155718046 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-methyl-5-(5-methyl-1,2-oxazol-4-yl)aniline |
| SMILES | Cc1ccc(-c2cnoc2C)cc1N |
| InChI | InChI=1S/C11H12N2O/c1-7-3-4-9(5-11(7)12)10-6-13-14-8(10)2/h3-6H,12H2,1-2H3 |
| InChIKey | DMFFJTBCJFCCFT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|