C12H14N2O — CID 69176055
2-ethyl-3-(5-methyl-1,2-oxazol-4-yl)aniline (PubChem CID 69176055) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-ethyl-3-(5-methyl-1,2-oxazol-4-yl)aniline.
| Compound Name | 2-ethyl-3-(5-methyl-1,2-oxazol-4-yl)aniline |
|---|---|
| PubChem CID | 69176055 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-ethyl-3-(5-methyl-1,2-oxazol-4-yl)aniline |
| SMILES | CCc1c(N)cccc1-c1cnoc1C |
| InChI | InChI=1S/C12H14N2O/c1-3-9-10(5-4-6-12(9)13)11-7-14-15-8(11)2/h4-7H,3,13H2,1-2H3 |
| InChIKey | KIGBIMAPXXVCRO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|