C22H25FN2O3 — CID 155718483
methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethanimidate (PubChem CID 155718483) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethanimidate.
| Compound Name | methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethanimidate |
|---|---|
| PubChem CID | 155718483 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethanimidate |
| SMILES | C=C(/N=C(\OC)C(NC(=O)OC(C)(C)C)c1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H25FN2O3/c1-15(17-12-9-13-18(23)14-17)24-20(27-5)19(16-10-7-6-8-11-16)25-21(26)28-22(2,3)4/h6-14,19H,1H2,2-5H3,(H,25,26)/b24-20- |
| InChIKey | VLOCGKCBLCCZKG-GFMRDNFCSA-N |
| XLogP | 5.11 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|