C16H23B4N3O2 — CID 155718749
CID 155718749 (PubChem CID 155718749) has the molecular formula C16H23B4N3O2 and a molecular weight of 332.63 g/mol.
| Compound Name | CID 155718749 |
|---|---|
| PubChem CID | 155718749 |
| Molecular Formula | C16H23B4N3O2 |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | — |
| SMILES | [B]C([B])(NC)C([B])([B])N1CCN(c2ccc(OCCOC)cc2)CC1 |
| InChI | InChI=1S/C16H23B4N3O2/c1-21-15(17,18)16(19,20)23-9-7-22(8-10-23)13-3-5-14(6-4-13)25-12-11-24-2/h3-6,21H,7-12H2,1-2H3 |
| InChIKey | VMIBSPKOTZIEKE-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|