C42H27CoN8 — CID 155720987
cobalt(3+);ethene;5,10,15,20-tetrapyridin-4-ylporphyrin-22,24-diide (PubChem CID 155720987) has the molecular formula C42H27CoN8 and a molecular weight of 702.67 g/mol. Its IUPAC name is cobalt(3+);ethene;5,10,15,20-tetrapyridin-4-ylporphyrin-22,24-diide.
| Compound Name | cobalt(3+);ethene;5,10,15,20-tetrapyridin-4-ylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 155720987 |
| Molecular Formula | C42H27CoN8 |
| Molecular Weight | 702.67 g/mol |
| Exact Mass | 702.17 |
| IUPAC Name | cobalt(3+);ethene;5,10,15,20-tetrapyridin-4-ylporphyrin-22,24-diide |
| SMILES | C1=Cc2nc1c(-c1ccncc1)c1ccc([n-]1)c(-c1ccncc1)c1nc(c(-c3ccncc3)c3ccc([n-]3)c2-c2ccncc2)C=C1.[Co+3].[H][C-]=C |
| InChI | InChI=1S/C40H24N8.C2H3.Co/c1-2-30-38(26-11-19-42-20-12-26)32-5-6-34(47-32)40(28-15-23-44-24-16-28)36-8-7-35(48-36)39(27-13-21-43-22-14-27)33-4-3-31(46-33)37(29(1)45-30)25-9-17-41-18-10-25;1-2;/h1-24H;1H,2H2;/q-2;-1;+3/b37-29-,37-31-,38-30-,38-32-,39-33-,39-35-,40-34-,40-36-;; |
| InChIKey | PCQZNAPXWCGMNL-NGRCPIEASA-N |
| XLogP | 8.76 |
| TPSA | 105.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.67 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|