C14H19F2N — CID 155721139
1-[2-(2,5-difluorophenyl)ethyl]-2-methylpiperidine (PubChem CID 155721139) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)ethyl]-2-methylpiperidine.
| Compound Name | 1-[2-(2,5-difluorophenyl)ethyl]-2-methylpiperidine |
|---|---|
| PubChem CID | 155721139 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)ethyl]-2-methylpiperidine |
| SMILES | CC1CCCCN1CCc1cc(F)ccc1F |
| InChI | InChI=1S/C14H19F2N/c1-11-4-2-3-8-17(11)9-7-12-10-13(15)5-6-14(12)16/h5-6,10-11H,2-4,7-9H2,1H3 |
| InChIKey | NPIMJXQSKVAINA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |