C15H22FN5 — CID 168590664
2-[[4-fluoro-2-[(2-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]guanidine (PubChem CID 168590664) has the molecular formula C15H22FN5 and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-[[4-fluoro-2-[(2-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[4-fluoro-2-[(2-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168590664 |
| Molecular Formula | C15H22FN5 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-[[4-fluoro-2-[(2-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]guanidine |
| SMILES | CC1CCCCN1Cc1cc(F)ccc1C=NN=C(N)N |
| InChI | InChI=1S/C15H22FN5/c1-11-4-2-3-7-21(11)10-13-8-14(16)6-5-12(13)9-19-20-15(17)18/h5-6,8-9,11H,2-4,7,10H2,1H3,(H4,17,18,20) |
| InChIKey | HUJPCULJGRJBDI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|